C28H25ClN2O3S — CID 167784239
N-[4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2,2-diphenylacetamide (PubChem CID 167784239) has the molecular formula C28H25ClN2O3S and a molecular weight of 505.04 g/mol. Its IUPAC name is N-[4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2,2-diphenylacetamide.
| Compound Name | N-[4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 167784239 |
| Molecular Formula | C28H25ClN2O3S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | N-[4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2,2-diphenylacetamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(NC(=O)C(c3ccccc3)c3ccccc3)ccc2Cl)c(C)c1 |
| InChI | InChI=1S/C28H25ClN2O3S/c1-19-13-16-25(20(2)17-19)31-35(33,34)26-18-23(14-15-24(26)29)30-28(32)27(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-18,27,31H,1-2H3,(H,30,32) |
| InChIKey | KUKADKZKTBIUGG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |