C14H13F3N2O3 — CID 167784680
4-(1,3-dioxolan-2-ylmethoxy)-1-[3-(trifluoromethyl)phenyl]pyrazole (PubChem CID 167784680) has the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-ylmethoxy)-1-[3-(trifluoromethyl)phenyl]pyrazole.
| Compound Name | 4-(1,3-dioxolan-2-ylmethoxy)-1-[3-(trifluoromethyl)phenyl]pyrazole |
|---|---|
| PubChem CID | 167784680 |
| Molecular Formula | C14H13F3N2O3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-(1,3-dioxolan-2-ylmethoxy)-1-[3-(trifluoromethyl)phenyl]pyrazole |
| SMILES | FC(F)(F)c1cccc(-n2cc(OCC3OCCO3)cn2)c1 |
| InChI | InChI=1S/C14H13F3N2O3/c15-14(16,17)10-2-1-3-11(6-10)19-8-12(7-18-19)22-9-13-20-4-5-21-13/h1-3,6-8,13H,4-5,9H2 |
| InChIKey | WRJVUKISZROEOH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |