C21H15N3O4S2 — CID 167784843
N-[4-[3-(2-prop-2-ynoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-sulfonamide (PubChem CID 167784843) has the molecular formula C21H15N3O4S2 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[4-[3-(2-prop-2-ynoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[3-(2-prop-2-ynoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 167784843 |
| Molecular Formula | C21H15N3O4S2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | N-[4-[3-(2-prop-2-ynoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-sulfonamide |
| SMILES | C#CCOc1ccccc1-c1noc(-c2ccc(NS(=O)(=O)c3cccs3)cc2)n1 |
| InChI | InChI=1S/C21H15N3O4S2/c1-2-13-27-18-7-4-3-6-17(18)20-22-21(28-23-20)15-9-11-16(12-10-15)24-30(25,26)19-8-5-14-29-19/h1,3-12,14,24H,13H2 |
| InChIKey | PEQYRAYBILQEAE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|