About propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate
propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate (PubChem CID 16778527) has the molecular formula C14H16N2O2S
and a molecular weight of 276.36 g/mol. Its IUPAC name is propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate.
Molecular Properties
| Compound Name | propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate |
| PubChem CID | 16778527 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate |
| SMILES | CCCOC(=O)c1ccc(Cc2cnc(N)s2)cc1 |
| InChI | InChI=1S/C14H16N2O2S/c1-2-7-18-13(17)11-5-3-10(4-6-11)8-12-9-16-14(15)19-12/h3-6,9H,2,7-8H2,1H3,(H2,15,16) |
| InChIKey | LZEGREKQIAAMFJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate?
The IUPAC name of propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate (CID 16778527) is propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate.
What is the SMILES notation for propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate?
The canonical SMILES for propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate is CCCOC(=O)c1ccc(Cc2cnc(N)s2)cc1.
What is the InChIKey of propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate?
The InChIKey is LZEGREKQIAAMFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S/c1-2-7-18-13(17)11-5-3-10(4-6-11)8-12-9-16-14(15)19-12/h3-6,9H,2,7-8H2,1H3,(H2,15,16).
What are the key properties of propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate?
propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate has a molecular weight of 276.36 g/mol, XLogP of 2.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate is sourced from PubChem (CID 16778527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).