C17H22N2O4S — CID 167785452
(6R)-6-benzyl-3-[(1,1-dioxothian-3-yl)methyl]-1,3-diazinane-2,4-dione (PubChem CID 167785452) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is (6R)-6-benzyl-3-[(1,1-dioxothian-3-yl)methyl]-1,3-diazinane-2,4-dione.
| Compound Name | (6R)-6-benzyl-3-[(1,1-dioxothian-3-yl)methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 167785452 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (6R)-6-benzyl-3-[(1,1-dioxothian-3-yl)methyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1C[C@@H](Cc2ccccc2)NC(=O)N1CC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22N2O4S/c20-16-10-15(9-13-5-2-1-3-6-13)18-17(21)19(16)11-14-7-4-8-24(22,23)12-14/h1-3,5-6,14-15H,4,7-12H2,(H,18,21)/t14?,15-/m1/s1 |
| InChIKey | MMNHOIWRQBJJKQ-YSSOQSIOSA-N |
| XLogP | 1.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |