C14H17F2NO3 — CID 167785474
(1R,5S)-5-[[(1R,5S)-3,3-difluorobicyclo[3.1.0]hexane-6-carbonyl]amino]cyclohex-3-ene-1-carboxylic acid (PubChem CID 167785474) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is (1R,5S)-5-[[(1R,5S)-3,3-difluorobicyclo[3.1.0]hexane-6-carbonyl]amino]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,5S)-5-[[(1R,5S)-3,3-difluorobicyclo[3.1.0]hexane-6-carbonyl]amino]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 167785474 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (1R,5S)-5-[[(1R,5S)-3,3-difluorobicyclo[3.1.0]hexane-6-carbonyl]amino]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(N[C@@H]1C=CC[C@@H](C(=O)O)C1)C1[C@H]2CC(F)(F)C[C@@H]12 |
| InChI | InChI=1S/C14H17F2NO3/c15-14(16)5-9-10(6-14)11(9)12(18)17-8-3-1-2-7(4-8)13(19)20/h1,3,7-11H,2,4-6H2,(H,17,18)(H,19,20)/t7-,8-,9-,10+,11?/m1/s1 |
| InChIKey | YEBPFPHZMSFDHQ-UZJMVKBUSA-N |
| XLogP | 1.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|