C14H10N2O5S — CID 167785734
methyl 3-nitro-5-(6-oxo-4,5-dihydrothieno[2,3-c]pyrrol-2-yl)benzoate (PubChem CID 167785734) has the molecular formula C14H10N2O5S and a molecular weight of 318.31 g/mol. Its IUPAC name is methyl 3-nitro-5-(6-oxo-4,5-dihydrothieno[2,3-c]pyrrol-2-yl)benzoate.
| Compound Name | methyl 3-nitro-5-(6-oxo-4,5-dihydrothieno[2,3-c]pyrrol-2-yl)benzoate |
|---|---|
| PubChem CID | 167785734 |
| Molecular Formula | C14H10N2O5S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | methyl 3-nitro-5-(6-oxo-4,5-dihydrothieno[2,3-c]pyrrol-2-yl)benzoate |
| SMILES | COC(=O)c1cc(-c2cc3c(s2)C(=O)NC3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10N2O5S/c1-21-14(18)8-2-7(3-10(4-8)16(19)20)11-5-9-6-15-13(17)12(9)22-11/h2-5H,6H2,1H3,(H,15,17) |
| InChIKey | YODBIBVJEHDGST-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|