About 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid
8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid (PubChem CID 167785983) has the molecular formula C18H18F2N2O3
and a molecular weight of 348.35 g/mol. Its IUPAC name is 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid.
Molecular Properties
| Compound Name | 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid |
| PubChem CID | 167785983 |
| Molecular Formula | C18H18F2N2O3 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCC2CC3(CO2)CC(F)(F)C3)c2ncccc12 |
| InChI | InChI=1S/C18H18F2N2O3/c19-18(20)8-17(9-18)6-11(25-10-17)7-22-14-4-3-13(16(23)24)12-2-1-5-21-15(12)14/h1-5,11,22H,6-10H2,(H,23,24) |
| InChIKey | WBKMQMSHJBINGP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid?
The IUPAC name of 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid (CID 167785983) is 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid.
What is the SMILES notation for 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid?
The canonical SMILES for 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid is O=C(O)c1ccc(NCC2CC3(CO2)CC(F)(F)C3)c2ncccc12.
What is the InChIKey of 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid?
The InChIKey is WBKMQMSHJBINGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2N2O3/c19-18(20)8-17(9-18)6-11(25-10-17)7-22-14-4-3-13(16(23)24)12-2-1-5-21-15(12)14/h1-5,11,22H,6-10H2,(H,23,24).
What are the key properties of 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid?
8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid has a molecular weight of 348.35 g/mol, XLogP of 3.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methylamino]quinoline-5-carboxylic acid is sourced from PubChem (CID 167785983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).