C17H14FN3O3S — CID 167785991
3-fluoro-N-(2-methylquinolin-8-yl)-4-sulfamoylbenzamide (PubChem CID 167785991) has the molecular formula C17H14FN3O3S and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-fluoro-N-(2-methylquinolin-8-yl)-4-sulfamoylbenzamide.
| Compound Name | 3-fluoro-N-(2-methylquinolin-8-yl)-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 167785991 |
| Molecular Formula | C17H14FN3O3S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 3-fluoro-N-(2-methylquinolin-8-yl)-4-sulfamoylbenzamide |
| SMILES | Cc1ccc2cccc(NC(=O)c3ccc(S(N)(=O)=O)c(F)c3)c2n1 |
| InChI | InChI=1S/C17H14FN3O3S/c1-10-5-6-11-3-2-4-14(16(11)20-10)21-17(22)12-7-8-15(13(18)9-12)25(19,23)24/h2-9H,1H3,(H,21,22)(H2,19,23,24) |
| InChIKey | GKQVLBXNPNOZEH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |