C16H19Cl2N3O2 — CID 167786234
N-(2,4-dichlorophenyl)-N-ethyl-2-oxo-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine-6-carboxamide (PubChem CID 167786234) has the molecular formula C16H19Cl2N3O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-N-ethyl-2-oxo-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine-6-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-N-ethyl-2-oxo-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 167786234 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-(2,4-dichlorophenyl)-N-ethyl-2-oxo-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine-6-carboxamide |
| SMILES | CCN(C(=O)N1CC2CCC(=O)NC2C1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl2N3O2/c1-2-21(14-5-4-11(17)7-12(14)18)16(23)20-8-10-3-6-15(22)19-13(10)9-20/h4-5,7,10,13H,2-3,6,8-9H2,1H3,(H,19,22) |
| InChIKey | BTFQBDQDKVTGJE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |