About tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate
tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate (PubChem CID 167786522) has the molecular formula C14H23N3O5S
and a molecular weight of 345.42 g/mol. Its IUPAC name is tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate |
| PubChem CID | 167786522 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)CCN1CC(c2cc(=O)[nH][nH]2)C1 |
| InChI | InChI=1S/C14H23N3O5S/c1-14(2,3)22-13(19)9-23(20,21)5-4-17-7-10(8-17)11-6-12(18)16-15-11/h6,10H,4-5,7-9H2,1-3H3,(H2,15,16,18) |
| InChIKey | GWFMEEUJXNGPMQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 112.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate?
The IUPAC name of tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate (CID 167786522) is tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate.
What is the SMILES notation for tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate?
The canonical SMILES for tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate is CC(C)(C)OC(=O)CS(=O)(=O)CCN1CC(c2cc(=O)[nH][nH]2)C1.
What is the InChIKey of tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate?
The InChIKey is GWFMEEUJXNGPMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O5S/c1-14(2,3)22-13(19)9-23(20,21)5-4-17-7-10(8-17)11-6-12(18)16-15-11/h6,10H,4-5,7-9H2,1-3H3,(H2,15,16,18).
What are the key properties of tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate?
tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate has a molecular weight of 345.42 g/mol, XLogP of -0.14, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[2-[3-(5-oxo-1,2-dihydropyrazol-3-yl)azetidin-1-yl]ethylsulfonyl]acetate is sourced from PubChem (CID 167786522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).