C16H20N2O4S — CID 167786535
2-[2-(2-methoxyphenoxy)ethylsulfonylmethyl]-3,5-dimethylpyrazine (PubChem CID 167786535) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenoxy)ethylsulfonylmethyl]-3,5-dimethylpyrazine.
| Compound Name | 2-[2-(2-methoxyphenoxy)ethylsulfonylmethyl]-3,5-dimethylpyrazine |
|---|---|
| PubChem CID | 167786535 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[2-(2-methoxyphenoxy)ethylsulfonylmethyl]-3,5-dimethylpyrazine |
| SMILES | COc1ccccc1OCCS(=O)(=O)Cc1ncc(C)nc1C |
| InChI | InChI=1S/C16H20N2O4S/c1-12-10-17-14(13(2)18-12)11-23(19,20)9-8-22-16-7-5-4-6-15(16)21-3/h4-7,10H,8-9,11H2,1-3H3 |
| InChIKey | HHGJNJQFKPRFOQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |