C30H37N5O5 — CID 167787996
3-[6-[[bis[(3-tert-butyl-1,2-oxazol-4-yl)methyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167787996) has the molecular formula C30H37N5O5 and a molecular weight of 547.66 g/mol. Its IUPAC name is 3-[6-[[bis[(3-tert-butyl-1,2-oxazol-4-yl)methyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[bis[(3-tert-butyl-1,2-oxazol-4-yl)methyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167787996 |
| Molecular Formula | C30H37N5O5 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 3-[6-[[bis[(3-tert-butyl-1,2-oxazol-4-yl)methyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)c1nocc1CN(Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)Cc1conc1C(C)(C)C |
| InChI | InChI=1S/C30H37N5O5/c1-29(2,3)25-20(16-39-32-25)13-34(14-21-17-40-33-26(21)30(4,5)6)12-18-7-8-22-19(11-18)15-35(28(22)38)23-9-10-24(36)31-27(23)37/h7-8,11,16-17,23H,9-10,12-15H2,1-6H3,(H,31,36,37) |
| InChIKey | UEQZGRBSMIRYNK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|