C15H24N2O3S — CID 167788384
cyclohexyl-[1-[(1-methylsulfonylcyclopropyl)methyl]imidazol-2-yl]methanol (PubChem CID 167788384) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is cyclohexyl-[1-[(1-methylsulfonylcyclopropyl)methyl]imidazol-2-yl]methanol.
| Compound Name | cyclohexyl-[1-[(1-methylsulfonylcyclopropyl)methyl]imidazol-2-yl]methanol |
|---|---|
| PubChem CID | 167788384 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | cyclohexyl-[1-[(1-methylsulfonylcyclopropyl)methyl]imidazol-2-yl]methanol |
| SMILES | CS(=O)(=O)C1(Cn2ccnc2C(O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C15H24N2O3S/c1-21(19,20)15(7-8-15)11-17-10-9-16-14(17)13(18)12-5-3-2-4-6-12/h9-10,12-13,18H,2-8,11H2,1H3 |
| InChIKey | RKFDYQYRVZKALK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |