C17H22N4S — CID 167788420
2-phenyl-5-(4-pyrrolidin-2-ylpiperidin-1-yl)-1,3,4-thiadiazole (PubChem CID 167788420) has the molecular formula C17H22N4S and a molecular weight of 314.46 g/mol. Its IUPAC name is 2-phenyl-5-(4-pyrrolidin-2-ylpiperidin-1-yl)-1,3,4-thiadiazole.
| Compound Name | 2-phenyl-5-(4-pyrrolidin-2-ylpiperidin-1-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 167788420 |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-phenyl-5-(4-pyrrolidin-2-ylpiperidin-1-yl)-1,3,4-thiadiazole |
| SMILES | c1ccc(-c2nnc(N3CCC(C4CCCN4)CC3)s2)cc1 |
| InChI | InChI=1S/C17H22N4S/c1-2-5-14(6-3-1)16-19-20-17(22-16)21-11-8-13(9-12-21)15-7-4-10-18-15/h1-3,5-6,13,15,18H,4,7-12H2 |
| InChIKey | CEKHMZUSXAYVSA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |