C19H17N5O — CID 167789497
1-[1-(2,3-dihydro-1H-inden-1-yl)prop-2-ynyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)urea (PubChem CID 167789497) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1H-inden-1-yl)prop-2-ynyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)urea.
| Compound Name | 1-[1-(2,3-dihydro-1H-inden-1-yl)prop-2-ynyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)urea |
|---|---|
| PubChem CID | 167789497 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[1-(2,3-dihydro-1H-inden-1-yl)prop-2-ynyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)urea |
| SMILES | C#CC(NC(=O)Nc1nnc2ccccn12)C1CCc2ccccc21 |
| InChI | InChI=1S/C19H17N5O/c1-2-16(15-11-10-13-7-3-4-8-14(13)15)20-19(25)21-18-23-22-17-9-5-6-12-24(17)18/h1,3-9,12,15-16H,10-11H2,(H2,20,21,23,25) |
| InChIKey | WPTXBYFZOLUWEI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|