About trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine
trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine (PubChem CID 167789498) has the molecular formula C14H25N3O3
and a molecular weight of 283.37 g/mol. Its IUPAC name is trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine.
Molecular Properties
| Compound Name | trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine |
| PubChem CID | 167789498 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine |
| SMILES | COc1cn(C)nc1C(C)NC1C[C@@H](OC)[C@H](OC)C1 |
| InChI | InChI=1S/C14H25N3O3/c1-9(14-13(20-5)8-17(2)16-14)15-10-6-11(18-3)12(7-10)19-4/h8-12,15H,6-7H2,1-5H3/t9?,11-,12-/m1/s1 |
| InChIKey | VQHFPUCQHLGOAV-JZXPMDSESA-N |
| XLogP | 1.27 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine?
The IUPAC name of trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine (CID 167789498) is trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine.
What is the SMILES notation for trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine?
The canonical SMILES for trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine is COc1cn(C)nc1C(C)NC1C[C@@H](OC)[C@H](OC)C1.
What is the InChIKey of trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine?
The InChIKey is VQHFPUCQHLGOAV-JZXPMDSESA-N. The full InChI is InChI=1S/C14H25N3O3/c1-9(14-13(20-5)8-17(2)16-14)15-10-6-11(18-3)12(7-10)19-4/h8-12,15H,6-7H2,1-5H3/t9?,11-,12-/m1/s1.
What are the key properties of trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine?
trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine has a molecular weight of 283.37 g/mol, XLogP of 1.27, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3R,4R)-3,4-dimethoxy-N-[1-(4-methoxy-1-methylpyrazol-3-yl)ethyl]cyclopentan-1-amine is sourced from PubChem (CID 167789498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).