About 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole
2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole (PubChem CID 167790526) has the molecular formula C11H10F2O4
and a molecular weight of 244.19 g/mol. Its IUPAC name is 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole.
Molecular Properties
| Compound Name | 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole |
| PubChem CID | 167790526 |
| Molecular Formula | C11H10F2O4 |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole |
| SMILES | FC1(F)Oc2ccc(OCC3COC3)cc2O1 |
| InChI | InChI=1S/C11H10F2O4/c12-11(13)16-9-2-1-8(3-10(9)17-11)15-6-7-4-14-5-7/h1-3,7H,4-6H2 |
| InChIKey | XYOVZTLCSRWLNI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole?
The IUPAC name of 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole (CID 167790526) is 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole.
What is the SMILES notation for 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole?
The canonical SMILES for 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole is FC1(F)Oc2ccc(OCC3COC3)cc2O1.
What is the InChIKey of 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole?
The InChIKey is XYOVZTLCSRWLNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2O4/c12-11(13)16-9-2-1-8(3-10(9)17-11)15-6-7-4-14-5-7/h1-3,7H,4-6H2.
What are the key properties of 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole?
2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole has a molecular weight of 244.19 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-5-(oxetan-3-ylmethoxy)-1,3-benzodioxole is sourced from PubChem (CID 167790526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).