C23H27N3O2 — CID 167791302
1-ethyl-2-[[3-(4-ethylphenyl)pyrrolidin-1-yl]methyl]benzimidazole-5-carboxylic acid (PubChem CID 167791302) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-ethyl-2-[[3-(4-ethylphenyl)pyrrolidin-1-yl]methyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-ethyl-2-[[3-(4-ethylphenyl)pyrrolidin-1-yl]methyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 167791302 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-ethyl-2-[[3-(4-ethylphenyl)pyrrolidin-1-yl]methyl]benzimidazole-5-carboxylic acid |
| SMILES | CCc1ccc(C2CCN(Cc3nc4cc(C(=O)O)ccc4n3CC)C2)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-3-16-5-7-17(8-6-16)19-11-12-25(14-19)15-22-24-20-13-18(23(27)28)9-10-21(20)26(22)4-2/h5-10,13,19H,3-4,11-12,14-15H2,1-2H3,(H,27,28) |
| InChIKey | MYEMTHUOXDBSJZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |