C18H20N4OS — CID 167791576
3-[4-(methylsulfanylmethyl)phenyl]-5-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)-1,2,4-oxadiazole (PubChem CID 167791576) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is 3-[4-(methylsulfanylmethyl)phenyl]-5-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-(methylsulfanylmethyl)phenyl]-5-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 167791576 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-[4-(methylsulfanylmethyl)phenyl]-5-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)-1,2,4-oxadiazole |
| SMILES | CSCc1ccc(-c2noc(C3CCn4cc(C)nc4C3)n2)cc1 |
| InChI | InChI=1S/C18H20N4OS/c1-12-10-22-8-7-15(9-16(22)19-12)18-20-17(21-23-18)14-5-3-13(4-6-14)11-24-2/h3-6,10,15H,7-9,11H2,1-2H3 |
| InChIKey | SKSBAZAYZDVENS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |