C19H18BNO6 — CID 167793493
[2-formyl-3-[2-oxo-2-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)ethoxy]phenyl]boronic acid (PubChem CID 167793493) has the molecular formula C19H18BNO6 and a molecular weight of 367.17 g/mol. Its IUPAC name is [2-formyl-3-[2-oxo-2-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)ethoxy]phenyl]boronic acid.
| Compound Name | [2-formyl-3-[2-oxo-2-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 167793493 |
| Molecular Formula | C19H18BNO6 |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [2-formyl-3-[2-oxo-2-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)ethoxy]phenyl]boronic acid |
| SMILES | O=Cc1c(OCC(=O)c2ccc3c(c2)CCCC(=O)N3)cccc1B(O)O |
| InChI | InChI=1S/C19H18BNO6/c22-10-14-15(20(25)26)4-2-5-18(14)27-11-17(23)13-7-8-16-12(9-13)3-1-6-19(24)21-16/h2,4-5,7-10,25-26H,1,3,6,11H2,(H,21,24) |
| InChIKey | CVFAKGRZJCTIPB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|