C16H25N3O2S — CID 167794123
N-[(3S,4R)-4-phenylpyrrolidin-3-yl]-1-piperidin-4-ylmethanesulfonamide (PubChem CID 167794123) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-[(3S,4R)-4-phenylpyrrolidin-3-yl]-1-piperidin-4-ylmethanesulfonamide.
| Compound Name | N-[(3S,4R)-4-phenylpyrrolidin-3-yl]-1-piperidin-4-ylmethanesulfonamide |
|---|---|
| PubChem CID | 167794123 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[(3S,4R)-4-phenylpyrrolidin-3-yl]-1-piperidin-4-ylmethanesulfonamide |
| SMILES | O=S(=O)(CC1CCNCC1)N[C@@H]1CNC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H25N3O2S/c20-22(21,12-13-6-8-17-9-7-13)19-16-11-18-10-15(16)14-4-2-1-3-5-14/h1-5,13,15-19H,6-12H2/t15-,16+/m0/s1 |
| InChIKey | FUCDFPIWCKJRRC-JKSUJKDBSA-N |
| XLogP | 0.66 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |