C24H23N3O2 — CID 167794474
7-[3-[(7-methoxynaphthalen-1-yl)methyl]-1,2,4-oxadiazol-5-yl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 167794474) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 7-[3-[(7-methoxynaphthalen-1-yl)methyl]-1,2,4-oxadiazol-5-yl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 7-[3-[(7-methoxynaphthalen-1-yl)methyl]-1,2,4-oxadiazol-5-yl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 167794474 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 7-[3-[(7-methoxynaphthalen-1-yl)methyl]-1,2,4-oxadiazol-5-yl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | COc1ccc2cccc(Cc3noc(-c4ccc5c(c4)C(N)CCC5)n3)c2c1 |
| InChI | InChI=1S/C24H23N3O2/c1-28-19-11-10-15-4-2-6-17(20(15)14-19)13-23-26-24(29-27-23)18-9-8-16-5-3-7-22(25)21(16)12-18/h2,4,6,8-12,14,22H,3,5,7,13,25H2,1H3 |
| InChIKey | FUDARDQKGQXGFH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |