About 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide
2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide (PubChem CID 167795062) has the molecular formula C22H27N3O4
and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide.
Molecular Properties
| Compound Name | 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide |
| PubChem CID | 167795062 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)NNc2cccc(C)c2C)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C22H27N3O4/c1-14-5-4-6-19(16(14)3)24-25-22(27)21(26)23-17-7-8-20(15(2)13-17)29-18-9-11-28-12-10-18/h4-8,13,18,24H,9-12H2,1-3H3,(H,23,26)(H,25,27) |
| InChIKey | PEOOKEKLGWGWCL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide?
The IUPAC name of 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide (CID 167795062) is 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide.
What is the SMILES notation for 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide?
The canonical SMILES for 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide is Cc1cc(NC(=O)C(=O)NNc2cccc(C)c2C)ccc1OC1CCOCC1.
What is the InChIKey of 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide?
The InChIKey is PEOOKEKLGWGWCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O4/c1-14-5-4-6-19(16(14)3)24-25-22(27)21(26)23-17-7-8-20(15(2)13-17)29-18-9-11-28-12-10-18/h4-8,13,18,24H,9-12H2,1-3H3,(H,23,26)(H,25,27).
What are the key properties of 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide?
2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide has a molecular weight of 397.48 g/mol, XLogP of 3.25, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,3-dimethylphenyl)hydrazinyl]-N-[3-methyl-4-(oxan-4-yloxy)phenyl]-2-oxoacetamide is sourced from PubChem (CID 167795062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).