C16H18BrN3O — CID 167795548
8-bromo-N-(2,2-dimethylcyclopentyl)-1,6-naphthyridine-2-carboxamide (PubChem CID 167795548) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is 8-bromo-N-(2,2-dimethylcyclopentyl)-1,6-naphthyridine-2-carboxamide.
| Compound Name | 8-bromo-N-(2,2-dimethylcyclopentyl)-1,6-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 167795548 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 8-bromo-N-(2,2-dimethylcyclopentyl)-1,6-naphthyridine-2-carboxamide |
| SMILES | CC1(C)CCCC1NC(=O)c1ccc2cncc(Br)c2n1 |
| InChI | InChI=1S/C16H18BrN3O/c1-16(2)7-3-4-13(16)20-15(21)12-6-5-10-8-18-9-11(17)14(10)19-12/h5-6,8-9,13H,3-4,7H2,1-2H3,(H,20,21) |
| InChIKey | HUBYCSOTRIRXLP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |