C19H22N4O2S — CID 167796154
8-[[2-(1-methylpyrazol-4-yl)piperidin-1-yl]sulfonylmethyl]quinoline (PubChem CID 167796154) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 8-[[2-(1-methylpyrazol-4-yl)piperidin-1-yl]sulfonylmethyl]quinoline.
| Compound Name | 8-[[2-(1-methylpyrazol-4-yl)piperidin-1-yl]sulfonylmethyl]quinoline |
|---|---|
| PubChem CID | 167796154 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 8-[[2-(1-methylpyrazol-4-yl)piperidin-1-yl]sulfonylmethyl]quinoline |
| SMILES | Cn1cc(C2CCCCN2S(=O)(=O)Cc2cccc3cccnc23)cn1 |
| InChI | InChI=1S/C19H22N4O2S/c1-22-13-17(12-21-22)18-9-2-3-11-23(18)26(24,25)14-16-7-4-6-15-8-5-10-20-19(15)16/h4-8,10,12-13,18H,2-3,9,11,14H2,1H3 |
| InChIKey | FARBUDBKHJWHMZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |