C22H23NO4 — CID 167796437
[4-(8-hydroxy-6-azaspiro[3.5]nonane-6-carbonyl)phenyl]-(3-hydroxyphenyl)methanone (PubChem CID 167796437) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is [4-(8-hydroxy-6-azaspiro[3.5]nonane-6-carbonyl)phenyl]-(3-hydroxyphenyl)methanone.
| Compound Name | [4-(8-hydroxy-6-azaspiro[3.5]nonane-6-carbonyl)phenyl]-(3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 167796437 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [4-(8-hydroxy-6-azaspiro[3.5]nonane-6-carbonyl)phenyl]-(3-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(C(=O)N2CC(O)CC3(CCC3)C2)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C22H23NO4/c24-18-4-1-3-17(11-18)20(26)15-5-7-16(8-6-15)21(27)23-13-19(25)12-22(14-23)9-2-10-22/h1,3-8,11,19,24-25H,2,9-10,12-14H2 |
| InChIKey | UXABFTIRNAEUBW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |