C15H16N4O2S — CID 167799143
6-[2-(piperidin-3-ylamino)-1,3-thiazol-4-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 167799143) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 6-[2-(piperidin-3-ylamino)-1,3-thiazol-4-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-(piperidin-3-ylamino)-1,3-thiazol-4-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 167799143 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 6-[2-(piperidin-3-ylamino)-1,3-thiazol-4-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(-c3csc(NC4CCCNC4)n3)cc2o1 |
| InChI | InChI=1S/C15H16N4O2S/c20-15-19-11-4-3-9(6-13(11)21-15)12-8-22-14(18-12)17-10-2-1-5-16-7-10/h3-4,6,8,10,16H,1-2,5,7H2,(H,17,18)(H,19,20) |
| InChIKey | IMRQZOZXCGMJJH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |