C18H22N2O — CID 167799237
5-(oxan-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-1-yl)-1H-pyrazole (PubChem CID 167799237) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 5-(oxan-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-1-yl)-1H-pyrazole.
| Compound Name | 5-(oxan-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-1-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 167799237 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 5-(oxan-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-1-yl)-1H-pyrazole |
| SMILES | c1cc2c(c(-c3cn[nH]c3C3CCOCC3)c1)CCCC2 |
| InChI | InChI=1S/C18H22N2O/c1-2-6-15-13(4-1)5-3-7-16(15)17-12-19-20-18(17)14-8-10-21-11-9-14/h3,5,7,12,14H,1-2,4,6,8-11H2,(H,19,20) |
| InChIKey | KYPRSAUKYYHBGX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |