About 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine
4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine (PubChem CID 167799398) has the molecular formula C14H14N2O4S
and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine |
| PubChem CID | 167799398 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine |
| SMILES | CC(C)c1conc1CS(=O)(=O)c1nccc2occc12 |
| InChI | InChI=1S/C14H14N2O4S/c1-9(2)11-7-20-16-12(11)8-21(17,18)14-10-4-6-19-13(10)3-5-15-14/h3-7,9H,8H2,1-2H3 |
| InChIKey | VZOCFNWGSMJLCW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine?
The IUPAC name of 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine (CID 167799398) is 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine.
What is the SMILES notation for 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine?
The canonical SMILES for 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine is CC(C)c1conc1CS(=O)(=O)c1nccc2occc12.
What is the InChIKey of 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine?
The InChIKey is VZOCFNWGSMJLCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O4S/c1-9(2)11-7-20-16-12(11)8-21(17,18)14-10-4-6-19-13(10)3-5-15-14/h3-7,9H,8H2,1-2H3.
What are the key properties of 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine?
4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine has a molecular weight of 306.34 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-propan-2-yl-1,2-oxazol-3-yl)methylsulfonyl]furo[3,2-c]pyridine is sourced from PubChem (CID 167799398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).