C15H22N6O3 — CID 167799876
1-(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone (PubChem CID 167799876) has the molecular formula C15H22N6O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 167799876 |
| Molecular Formula | C15H22N6O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)N1CCC2C(CCCN2C2CC2)C1 |
| InChI | InChI=1S/C15H22N6O3/c22-14(9-19-10-16-15(17-19)21(23)24)18-7-5-13-11(8-18)2-1-6-20(13)12-3-4-12/h10-13H,1-9H2 |
| InChIKey | FVUXJGAIEZQQIJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|