C13H13Cl2F3N2O — CID 167799891
[(3aR,6aR)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(4,5-dichloro-1H-pyrrol-2-yl)methanone (PubChem CID 167799891) has the molecular formula C13H13Cl2F3N2O and a molecular weight of 341.16 g/mol. Its IUPAC name is [(3aR,6aR)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(4,5-dichloro-1H-pyrrol-2-yl)methanone.
| Compound Name | [(3aR,6aR)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(4,5-dichloro-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 167799891 |
| Molecular Formula | C13H13Cl2F3N2O |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | [(3aR,6aR)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(4,5-dichloro-1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1cc(Cl)c(Cl)[nH]1)N1C[C@@H]2CCC[C@]2(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H13Cl2F3N2O/c14-8-4-9(19-10(8)15)11(21)20-5-7-2-1-3-12(7,6-20)13(16,17)18/h4,7,19H,1-3,5-6H2/t7-,12-/m0/s1 |
| InChIKey | ZHHOHHNJICBLDR-MADCSZMMSA-N |
| XLogP | 4.13 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |