C20H23N5 — CID 167800061
N-[(1-phenylimidazol-2-yl)methyl]-4-piperazin-1-ylaniline (PubChem CID 167800061) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[(1-phenylimidazol-2-yl)methyl]-4-piperazin-1-ylaniline.
| Compound Name | N-[(1-phenylimidazol-2-yl)methyl]-4-piperazin-1-ylaniline |
|---|---|
| PubChem CID | 167800061 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | N-[(1-phenylimidazol-2-yl)methyl]-4-piperazin-1-ylaniline |
| SMILES | c1ccc(-n2ccnc2CNc2ccc(N3CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C20H23N5/c1-2-4-19(5-3-1)25-15-12-22-20(25)16-23-17-6-8-18(9-7-17)24-13-10-21-11-14-24/h1-9,12,15,21,23H,10-11,13-14,16H2 |
| InChIKey | OLTBCXMTDLMRAD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|