About [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate
[(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate (PubChem CID 167800242) has the molecular formula C17H15N3O3S
and a molecular weight of 341.39 g/mol. Its IUPAC name is [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate |
| PubChem CID | 167800242 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate |
| SMILES | COc1ccccc1[C@H](C)OC(=O)c1csc(-c2ncccn2)n1 |
| InChI | InChI=1S/C17H15N3O3S/c1-11(12-6-3-4-7-14(12)22-2)23-17(21)13-10-24-16(20-13)15-18-8-5-9-19-15/h3-11H,1-2H3/t11-/m0/s1 |
| InChIKey | JOZIJKSAJINFKL-NSHDSACASA-N |
| XLogP | 3.53 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate?
The IUPAC name of [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate (CID 167800242) is [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate?
The canonical SMILES for [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate is COc1ccccc1[C@H](C)OC(=O)c1csc(-c2ncccn2)n1.
What is the InChIKey of [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate?
The InChIKey is JOZIJKSAJINFKL-NSHDSACASA-N. The full InChI is InChI=1S/C17H15N3O3S/c1-11(12-6-3-4-7-14(12)22-2)23-17(21)13-10-24-16(20-13)15-18-8-5-9-19-15/h3-11H,1-2H3/t11-/m0/s1.
What are the key properties of [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate?
[(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate has a molecular weight of 341.39 g/mol, XLogP of 3.53, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(2-methoxyphenyl)ethyl] 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 167800242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).