About 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate
1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate (PubChem CID 167800300) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate |
| PubChem CID | 167800300 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OCc2ccc3[nH]ncc3c2)CC1 |
| InChI | InChI=1S/C13H14N2O2/c1-13(4-5-13)12(16)17-8-9-2-3-11-10(6-9)7-14-15-11/h2-3,6-7H,4-5,8H2,1H3,(H,14,15) |
| InChIKey | MXQHSITUANNWEQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate?
The IUPAC name of 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate (CID 167800300) is 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate.
What is the SMILES notation for 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate?
The canonical SMILES for 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate is CC1(C(=O)OCc2ccc3[nH]ncc3c2)CC1.
What is the InChIKey of 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate?
The InChIKey is MXQHSITUANNWEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-13(4-5-13)12(16)17-8-9-2-3-11-10(6-9)7-14-15-11/h2-3,6-7H,4-5,8H2,1H3,(H,14,15).
What are the key properties of 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate?
1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate has a molecular weight of 230.27 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazol-5-ylmethyl 1-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 167800300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).