C19H21N3O3S — CID 167800583
1-(2,2-dimethyl-1-thiophen-2-ylpropyl)-3-(2-methyl-1,3-dioxoisoindol-5-yl)urea (PubChem CID 167800583) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-(2,2-dimethyl-1-thiophen-2-ylpropyl)-3-(2-methyl-1,3-dioxoisoindol-5-yl)urea.
| Compound Name | 1-(2,2-dimethyl-1-thiophen-2-ylpropyl)-3-(2-methyl-1,3-dioxoisoindol-5-yl)urea |
|---|---|
| PubChem CID | 167800583 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-(2,2-dimethyl-1-thiophen-2-ylpropyl)-3-(2-methyl-1,3-dioxoisoindol-5-yl)urea |
| SMILES | CN1C(=O)c2ccc(NC(=O)NC(c3cccs3)C(C)(C)C)cc2C1=O |
| InChI | InChI=1S/C19H21N3O3S/c1-19(2,3)15(14-6-5-9-26-14)21-18(25)20-11-7-8-12-13(10-11)17(24)22(4)16(12)23/h5-10,15H,1-4H3,(H2,20,21,25) |
| InChIKey | QTYFPCKNPGAMPR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|