C16H20N4O2 — CID 167800689
(2R,3S)-2-[1-(6-cyano-2-pyridinyl)piperidin-4-yl]oxolane-3-carboxamide (PubChem CID 167800689) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (2R,3S)-2-[1-(6-cyano-2-pyridinyl)piperidin-4-yl]oxolane-3-carboxamide.
| Compound Name | (2R,3S)-2-[1-(6-cyano-2-pyridinyl)piperidin-4-yl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 167800689 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (2R,3S)-2-[1-(6-cyano-2-pyridinyl)piperidin-4-yl]oxolane-3-carboxamide |
| SMILES | N#Cc1cccc(N2CCC([C@H]3OCC[C@@H]3C(N)=O)CC2)n1 |
| InChI | InChI=1S/C16H20N4O2/c17-10-12-2-1-3-14(19-12)20-7-4-11(5-8-20)15-13(16(18)21)6-9-22-15/h1-3,11,13,15H,4-9H2,(H2,18,21)/t13-,15+/m0/s1 |
| InChIKey | YBEQSFNDZLDUPF-DZGCQCFKSA-N |
| XLogP | 1.06 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |