C20H20FN3O3 — CID 167800919
N-(3-fluoro-5-methylphenyl)-N'-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]oxamide (PubChem CID 167800919) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is N-(3-fluoro-5-methylphenyl)-N'-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]oxamide.
| Compound Name | N-(3-fluoro-5-methylphenyl)-N'-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 167800919 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-(3-fluoro-5-methylphenyl)-N'-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]oxamide |
| SMILES | Cc1cc(F)cc(NC(=O)C(=O)NC(C)c2ccc3c(c2)CCC(=O)N3)c1 |
| InChI | InChI=1S/C20H20FN3O3/c1-11-7-15(21)10-16(8-11)23-20(27)19(26)22-12(2)13-3-5-17-14(9-13)4-6-18(25)24-17/h3,5,7-10,12H,4,6H2,1-2H3,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | IKBMIVPGVVWTBS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|