C15H17ClFN3O — CID 167801224
6-butan-2-yloxy-N-(3-chloro-4-fluorophenyl)-2-methylpyrimidin-4-amine (PubChem CID 167801224) has the molecular formula C15H17ClFN3O and a molecular weight of 309.77 g/mol. Its IUPAC name is 6-butan-2-yloxy-N-(3-chloro-4-fluorophenyl)-2-methylpyrimidin-4-amine.
| Compound Name | 6-butan-2-yloxy-N-(3-chloro-4-fluorophenyl)-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 167801224 |
| Molecular Formula | C15H17ClFN3O |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 6-butan-2-yloxy-N-(3-chloro-4-fluorophenyl)-2-methylpyrimidin-4-amine |
| SMILES | CCC(C)Oc1cc(Nc2ccc(F)c(Cl)c2)nc(C)n1 |
| InChI | InChI=1S/C15H17ClFN3O/c1-4-9(2)21-15-8-14(18-10(3)19-15)20-11-5-6-13(17)12(16)7-11/h5-9H,4H2,1-3H3,(H,18,19,20) |
| InChIKey | FSYNSONAGPSWDO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |