C26H24N4O3 — CID 167801688
N-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-3-phenyl-2,3-dihydroindole-1-carboxamide (PubChem CID 167801688) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-3-phenyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-3-phenyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 167801688 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-3-phenyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CC1(c2ccc(CNC(=O)N3CC(c4ccccc4)c4ccccc43)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C26H24N4O3/c1-26(23(31)28-24(32)29-26)19-13-11-17(12-14-19)15-27-25(33)30-16-21(18-7-3-2-4-8-18)20-9-5-6-10-22(20)30/h2-14,21H,15-16H2,1H3,(H,27,33)(H2,28,29,31,32) |
| InChIKey | JRYHZZCOJNBPDM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|