C26H28N4O3 — CID 167803049
4-[4-(3-methoxy-4-pyridinyl)piperazine-1-carbonyl]-N-[(3-methylphenyl)methyl]benzamide (PubChem CID 167803049) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 4-[4-(3-methoxy-4-pyridinyl)piperazine-1-carbonyl]-N-[(3-methylphenyl)methyl]benzamide.
| Compound Name | 4-[4-(3-methoxy-4-pyridinyl)piperazine-1-carbonyl]-N-[(3-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 167803049 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-[4-(3-methoxy-4-pyridinyl)piperazine-1-carbonyl]-N-[(3-methylphenyl)methyl]benzamide |
| SMILES | COc1cnccc1N1CCN(C(=O)c2ccc(C(=O)NCc3cccc(C)c3)cc2)CC1 |
| InChI | InChI=1S/C26H28N4O3/c1-19-4-3-5-20(16-19)17-28-25(31)21-6-8-22(9-7-21)26(32)30-14-12-29(13-15-30)23-10-11-27-18-24(23)33-2/h3-11,16,18H,12-15,17H2,1-2H3,(H,28,31) |
| InChIKey | NNZHVEFDIDOPDQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |