C13H16INO2 — CID 167803355
(2,3-dimethylpyrrolidin-1-yl)-(2-hydroxy-6-iodophenyl)methanone (PubChem CID 167803355) has the molecular formula C13H16INO2 and a molecular weight of 345.18 g/mol. Its IUPAC name is (2,3-dimethylpyrrolidin-1-yl)-(2-hydroxy-6-iodophenyl)methanone.
| Compound Name | (2,3-dimethylpyrrolidin-1-yl)-(2-hydroxy-6-iodophenyl)methanone |
|---|---|
| PubChem CID | 167803355 |
| Molecular Formula | C13H16INO2 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | (2,3-dimethylpyrrolidin-1-yl)-(2-hydroxy-6-iodophenyl)methanone |
| SMILES | CC1CCN(C(=O)c2c(O)cccc2I)C1C |
| InChI | InChI=1S/C13H16INO2/c1-8-6-7-15(9(8)2)13(17)12-10(14)4-3-5-11(12)16/h3-5,8-9,16H,6-7H2,1-2H3 |
| InChIKey | GNXCRIZIYVWDRL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|