C36H30FN7O2S2 — CID 167803519
N-[3-[[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]carbamoyl]cyclobutyl]-5-[4-(5-phenylthiophen-2-yl)triazol-1-yl]pyridine-3-carboxamide (PubChem CID 167803519) has the molecular formula C36H30FN7O2S2 and a molecular weight of 675.82 g/mol. Its IUPAC name is N-[3-[[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]carbamoyl]cyclobutyl]-5-[4-(5-phenylthiophen-2-yl)triazol-1-yl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]carbamoyl]cyclobutyl]-5-[4-(5-phenylthiophen-2-yl)triazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167803519 |
| Molecular Formula | C36H30FN7O2S2 |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 675.19 |
| IUPAC Name | N-[3-[[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]carbamoyl]cyclobutyl]-5-[4-(5-phenylthiophen-2-yl)triazol-1-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CC(C(=O)NC2CCCc3nc(-c4ccc(F)cc4)sc32)C1)c1cncc(-n2cc(-c3ccc(-c4ccccc4)s3)nn2)c1 |
| InChI | InChI=1S/C36H30FN7O2S2/c37-25-11-9-22(10-12-25)36-41-29-8-4-7-28(33(29)48-36)40-34(45)23-15-26(16-23)39-35(46)24-17-27(19-38-18-24)44-20-30(42-43-44)32-14-13-31(47-32)21-5-2-1-3-6-21/h1-3,5-6,9-14,17-20,23,26,28H,4,7-8,15-16H2,(H,39,46)(H,40,45) |
| InChIKey | YKKGARMQLKLFLQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |