C9H8F4N2O2S — CID 16780366
[6-(2,2,3,3-tetrafluoropropoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanol (PubChem CID 16780366) has the molecular formula C9H8F4N2O2S and a molecular weight of 284.23 g/mol. Its IUPAC name is [6-(2,2,3,3-tetrafluoropropoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanol.
| Compound Name | [6-(2,2,3,3-tetrafluoropropoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 16780366 |
| Molecular Formula | C9H8F4N2O2S |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | [6-(2,2,3,3-tetrafluoropropoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanol |
| SMILES | OCc1c(OCC(F)(F)C(F)F)nc2sccn12 |
| InChI | InChI=1S/C9H8F4N2O2S/c10-7(11)9(12,13)4-17-6-5(3-16)15-1-2-18-8(15)14-6/h1-2,7,16H,3-4H2 |
| InChIKey | YNICDJVRRDBKHO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|