C17H23F3N4O2 — CID 167803896
N,N-dimethyl-1-[5-[(4-propan-2-ylphenyl)methyl]-1H-1,2,4-triazol-3-yl]methanamine;2,2,2-trifluoroacetic acid (PubChem CID 167803896) has the molecular formula C17H23F3N4O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is N,N-dimethyl-1-[5-[(4-propan-2-ylphenyl)methyl]-1H-1,2,4-triazol-3-yl]methanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-1-[5-[(4-propan-2-ylphenyl)methyl]-1H-1,2,4-triazol-3-yl]methanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167803896 |
| Molecular Formula | C17H23F3N4O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N,N-dimethyl-1-[5-[(4-propan-2-ylphenyl)methyl]-1H-1,2,4-triazol-3-yl]methanamine;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)c1ccc(Cc2nc(CN(C)C)n[nH]2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N4.C2HF3O2/c1-11(2)13-7-5-12(6-8-13)9-14-16-15(18-17-14)10-19(3)4;3-2(4,5)1(6)7/h5-8,11H,9-10H2,1-4H3,(H,16,17,18);(H,6,7) |
| InChIKey | PTTTUUMSZOTEIC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |