C14H17ClN2O2 — CID 167804593
1-(2-chloroacetyl)-N,N-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 167804593) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is 1-(2-chloroacetyl)-N,N-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | 1-(2-chloroacetyl)-N,N-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 167804593 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-(2-chloroacetyl)-N,N-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)CCCN2C(=O)CCl |
| InChI | InChI=1S/C14H17ClN2O2/c1-16(2)14(19)11-5-6-12-10(8-11)4-3-7-17(12)13(18)9-15/h5-6,8H,3-4,7,9H2,1-2H3 |
| InChIKey | SMAFULYHVTZNJF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|