About ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate
ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate (PubChem CID 167805681) has the molecular formula C13H18N4O3
and a molecular weight of 278.31 g/mol. Its IUPAC name is ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate |
| PubChem CID | 167805681 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1OCCn1nc(C)cc1C |
| InChI | InChI=1S/C13H18N4O3/c1-4-19-13(18)11-8-14-15-12(11)20-6-5-17-10(3)7-9(2)16-17/h7-8H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | KYZFDVQZQZFREJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate?
The IUPAC name of ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate (CID 167805681) is ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate is CCOC(=O)c1cn[nH]c1OCCn1nc(C)cc1C.
What is the InChIKey of ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate?
The InChIKey is KYZFDVQZQZFREJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O3/c1-4-19-13(18)11-8-14-15-12(11)20-6-5-17-10(3)7-9(2)16-17/h7-8H,4-6H2,1-3H3,(H,14,15).
What are the key properties of ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate?
ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate has a molecular weight of 278.31 g/mol, XLogP of 1.48, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]-1H-pyrazole-4-carboxylate is sourced from PubChem (CID 167805681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).