C20H23N5O4 — CID 167805801
2-amino-N-[3-[[4-(carbamoylamino)benzoyl]amino]cyclobutyl]-5-methoxybenzamide (PubChem CID 167805801) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-amino-N-[3-[[4-(carbamoylamino)benzoyl]amino]cyclobutyl]-5-methoxybenzamide.
| Compound Name | 2-amino-N-[3-[[4-(carbamoylamino)benzoyl]amino]cyclobutyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 167805801 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-amino-N-[3-[[4-(carbamoylamino)benzoyl]amino]cyclobutyl]-5-methoxybenzamide |
| SMILES | COc1ccc(N)c(C(=O)NC2CC(NC(=O)c3ccc(NC(N)=O)cc3)C2)c1 |
| InChI | InChI=1S/C20H23N5O4/c1-29-15-6-7-17(21)16(10-15)19(27)24-14-8-13(9-14)23-18(26)11-2-4-12(5-3-11)25-20(22)28/h2-7,10,13-14H,8-9,21H2,1H3,(H,23,26)(H,24,27)(H3,22,25,28) |
| InChIKey | NUVGPOOAGFDPQB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|