C23H26F2N4O3 — CID 167806101
N-(6,8-difluoro-3,4-dihydro-2H-chromen-3-yl)-N'-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide (PubChem CID 167806101) has the molecular formula C23H26F2N4O3 and a molecular weight of 444.48 g/mol. Its IUPAC name is N-(6,8-difluoro-3,4-dihydro-2H-chromen-3-yl)-N'-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide.
| Compound Name | N-(6,8-difluoro-3,4-dihydro-2H-chromen-3-yl)-N'-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 167806101 |
| Molecular Formula | C23H26F2N4O3 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-(6,8-difluoro-3,4-dihydro-2H-chromen-3-yl)-N'-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NC2COc3c(F)cc(F)cc3C2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C23H26F2N4O3/c1-14-9-17(3-4-20(14)29-7-5-28(2)6-8-29)26-22(30)23(31)27-18-11-15-10-16(24)12-19(25)21(15)32-13-18/h3-4,9-10,12,18H,5-8,11,13H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | LMXBEVZNQJWXRY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|