About 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide
3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide (PubChem CID 167807803) has the molecular formula C13H13N3O4S2
and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide |
| PubChem CID | 167807803 |
| Molecular Formula | C13H13N3O4S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide |
| SMILES | COc1nscc1S(=O)(=O)Nc1ccc2c(n1)CCCC2=O |
| InChI | InChI=1S/C13H13N3O4S2/c1-20-13-11(7-21-15-13)22(18,19)16-12-6-5-8-9(14-12)3-2-4-10(8)17/h5-7H,2-4H2,1H3,(H,14,16) |
| InChIKey | RZOLKKRQBZWRCZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide?
The IUPAC name of 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide (CID 167807803) is 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide.
What is the SMILES notation for 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide?
The canonical SMILES for 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide is COc1nscc1S(=O)(=O)Nc1ccc2c(n1)CCCC2=O.
What is the InChIKey of 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide?
The InChIKey is RZOLKKRQBZWRCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4S2/c1-20-13-11(7-21-15-13)22(18,19)16-12-6-5-8-9(14-12)3-2-4-10(8)17/h5-7H,2-4H2,1H3,(H,14,16).
What are the key properties of 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide?
3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide has a molecular weight of 339.40 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-1,2-thiazole-4-sulfonamide is sourced from PubChem (CID 167807803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).